| Ürün Adı |
4- (2,4-diklorofenoksi) bütirik asit, dimetilamin (1: 1) ile bileşik |
| Eş anlamlı |
2,4-DB-dimetilamonyum [ISO]; 2,4-DB dimetilamin tuzu; 2,4-DB-Dimetilamonyum; 4- (2,4-Diklorofenoksi) bütirik asit dimetilamin tuzu; CCRIS 8800; Caswell Hayır.316C; EPA Pestisit Kimyasal Kodu 030819; 4- (2,4-Diklorofenoksi) bütirik asit, dimetilamin (1: 1) ile bileşik; Bütanoik asit, 4-(2,4-diklorofenoksi)-, compd.N-metilmetanamin (1:1) ile; Butirik asit, 4- (2,4-diklorofenoksi) -, dimetilamin tuzu; Dimetilamin 4- (2,4-diklorofenoksi) bütirat; 4- (2,4-diklorofenoksi) bütanoik asit - N-metilmetanamin (1: 1);
|
| ingilizce adı |
4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1);2,4-DB-dimethylammonium [ISO]; 2,4-DB dimethylamine salt; 2,4-DB-Dimethylammonium; 4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt; CCRIS 8800; Caswell No. 316C; EPA Pesticide Chemical Code 030819; 4-(2,4-Dichlorophenoxy)butyric acid, compound with dimethylamine (1:1); Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1); Butyric acid, 4-(2,4-dichlorophenoxy)-, dimethylamine salt; Dimethylamine 4-(2,4-dichlorophenoxy)butyrate; 4-(2,4-dichlorophenoxy)butanoic acid - N-methylmethanamine (1:1) |
| Moleküler Formülü |
C12H17Cl2NO3 |
| Molekül Ağırlığı |
294.1743 |
| InChI |
InChI=1/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
| CAS kayıt numarası |
2758-42-1 |
| EINECS |
220-422-0 |
| Moleküler Yapısı |
|
| Kaynama noktası |
410.4°C at 760 mmHg |
| Alevlenme noktası |
202°C |
| Buhar basıncı |
1.8E-07mmHg at 25°C |
|